CAS 1643-39-6
:Phenol, 2-amino-4,6-bis(1,1-dimethylethyl)-
Description:
Phenol, 2-amino-4,6-bis(1,1-dimethylethyl)-, also known as 2-amino-4,6-bis(tert-butyl)phenol, is an organic compound characterized by its phenolic structure with amino and tert-butyl substituents. This compound features a hydroxyl group (-OH) attached to a benzene ring, which is further substituted at the 2-position with an amino group (-NH2) and at the 4 and 6 positions with two tert-butyl groups. These bulky tert-butyl groups contribute to its hydrophobic nature and influence its solubility in organic solvents. The presence of the amino group imparts basic properties, allowing it to participate in various chemical reactions, including nucleophilic substitutions. This compound is often utilized as an antioxidant in various industrial applications, particularly in plastics and rubber, due to its ability to scavenge free radicals and prevent oxidative degradation. Additionally, its structural features may confer stability and resistance to thermal degradation, making it valuable in formulations requiring enhanced durability. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.
Formula:C14H23NO
InChI:InChI=1S/C14H23NO/c1-13(2,3)9-7-10(14(4,5)6)12(16)11(15)8-9/h7-8,16H,15H2,1-6H3
InChI key:IVVMNEWWVJXCLX-UHFFFAOYSA-N
SMILES:CC(C)(C)C1=CC(=C(C(=C1)N)O)C(C)(C)C
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
2-Amino-4,6-di-tert-butylphenol
CAS:2-Amino-4,6-di-tert-butylphenolFormula:C14H23NOPurity:98%Molecular weight:221.3442-Amino-4,6-di-tert-butylphenol
CAS:Formula:C14H23NOPurity:98%Color and Shape:SolidMolecular weight:221.33852-Amino-4,6-di-tert-butylphenol
CAS:2-Amino-4,6-di-tert-butylphenolFormula:C14H23NOPurity:98%Molecular weight:221.342-Amino-4,6-di-tert-butylphenol
CAS:Formula:C14H23NOPurity:98%Color and Shape:No data available.Molecular weight:221.3442-Amino-4,6-di-tert-butylphenol
CAS:2-Amino-4,6-di-tert-butylphenol is a phenolic compound that has antiviral properties. It reacts with nucleophiles to form 2-amino-4,6-di-(tertiary butyl)phenoxide and 2,4,6-triaminophenol. The functional theory for the antiviral activity of 2-amino-4,6-di-(tertiary butyl)phenol is based on its ability to react with nucleophiles and form products that inhibit viral replication. This agent has been shown to be effective against Mycobacterium tuberculosis and Mycobacterium avium complex in cell culture studies. 2AAP inhibits the growth of human cancer cells in vitro by blocking the synthesis of DNA and RNA. It also inhibits protein synthesis by binding to methylamine groups in proteins and inhibiting the release of aminoacyl adenosine triphosphate (ATPFormula:C14H23NOPurity:Min. 95%Molecular weight:221.34 g/mol





