CymitQuimica logo

CAS 164323-84-6

:

(S)-3-Piperidinecarboxylic acid methyl ester hydrochloride

Description:
(S)-3-Piperidinecarboxylic acid methyl ester hydrochloride is a chemical compound characterized by its piperidine ring structure, which is a six-membered ring containing one nitrogen atom. This compound is a chiral molecule, with the "(S)" designation indicating its specific stereochemistry, which can influence its biological activity and interactions. As a methyl ester, it features a methoxy group attached to the carboxylic acid, enhancing its solubility and reactivity. The hydrochloride form indicates that the compound is a salt, which typically improves its stability and solubility in aqueous solutions. This substance is often utilized in pharmaceutical research and development due to its potential applications in drug synthesis and as a building block for various bioactive compounds. Its properties, such as melting point, solubility, and reactivity, can vary based on the specific conditions and purity of the sample. Overall, (S)-3-Piperidinecarboxylic acid methyl ester hydrochloride is significant in medicinal chemistry and related fields.
Formula:C7H14ClNO2
InChI:InChI=1/C7H13NO2.ClH/c1-10-7(9)6-3-2-4-8-5-6;/h6,8H,2-5H2,1H3;1H/t6-;/m0./s1
InChI key:BQQZKNAQDKIGGZ-RGMNGODLSA-N
SMILES:COC(=O)[C@H]1CCCNC1.Cl
Synonyms:
  • (S)-3-Methyl Piperidine Carboxylate Hydrochloride
  • L-Glu.OBZl
  • (S)-Methyl piperidine-3-carboxylate hydrochloride
Found 4 products.