CAS 1644-73-1
:4-Chlorophenyl carbonofluoridate
Description:
4-Chlorophenyl carbonofluoridate, with the CAS number 1644-73-1, is an organic compound characterized by the presence of a chlorophenyl group and a carbonofluoridate functional group. It typically appears as a colorless to pale yellow liquid and is known for its reactivity, particularly in nucleophilic substitution reactions due to the presence of the carbonofluoridate moiety. This compound is often utilized in organic synthesis, particularly in the preparation of various fluorinated compounds, which are valuable in pharmaceuticals and agrochemicals. Its chemical structure includes a chlorine atom attached to the phenyl ring, which can influence its reactivity and stability. Additionally, 4-Chlorophenyl carbonofluoridate may exhibit moderate toxicity, necessitating careful handling and appropriate safety measures during its use in laboratory or industrial settings. As with many fluorinated compounds, it may also have environmental implications, particularly regarding persistence and bioaccumulation, warranting consideration in regulatory assessments.
Formula:C7H4ClFO2
InChI:InChI=1S/C7H4ClFO2/c8-5-1-3-6(4-2-5)11-7(9)10/h1-4H
InChI key:InChIKey=RXUMATUDAVHUGS-UHFFFAOYSA-N
SMILES:O(C(F)=O)C1=CC=C(Cl)C=C1
Synonyms:- Formic acid, fluoro-, p-chlorophenyl ester
- 4-Chlorophenyl carbonofluoridate
- Carbonofluoridic acid, 4-chlorophenyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
