CymitQuimica logo

CAS 1644-85-5

:

5-FLUOROBENZOTHIAZOLE

Description:
5-Fluorobenzothiazole is a heterocyclic compound characterized by the presence of both a benzene ring and a thiazole ring, with a fluorine atom substituted at the 5-position of the thiazole. Its molecular formula is C7H4FN2S, indicating the presence of carbon, hydrogen, fluorine, nitrogen, and sulfur atoms. This compound typically appears as a solid or crystalline substance and is known for its aromatic properties, which contribute to its stability and reactivity. 5-Fluorobenzothiazole is often utilized in various chemical applications, including as an intermediate in the synthesis of pharmaceuticals and agrochemicals. Its fluorine substitution can enhance biological activity and lipophilicity, making it a valuable compound in medicinal chemistry. Additionally, it may exhibit specific biological activities, including antimicrobial or antifungal properties, although the extent of these activities can vary based on the context of its use. Proper handling and safety measures are essential due to its potential toxicity and environmental impact.
Formula:C7H4FNS
InChI:InChI=1S/C7H4FNS/c8-5-1-2-7-6(3-5)9-4-10-7/h1-4H
InChI key:ANEKYSBZODRVRB-UHFFFAOYSA-N
SMILES:C1=CC2=C(C=C1F)N=CS2
Synonyms:
  • Benzothiazole, 5-fluoro- (7CI,8CI,9CI)
Found 4 products.