CAS 16441-29-5

2-(3-METHYLPHENYL)-1,3-THIAZOL-4-YL]ACETIC ACID

Description:

2-(3-Methylphenyl)-1,3-thiazol-4-yl]acetic acid, identified by its CAS number 16441-29-5, is a chemical compound that features a thiazole ring, which is a five-membered heterocyclic structure containing sulfur and nitrogen. This compound is characterized by the presence of a 3-methylphenyl group, which contributes to its aromatic properties and potential biological activity. The acetic acid functional group indicates that it possesses acidic characteristics, making it soluble in polar solvents. The thiazole moiety is known for its role in various biological activities, including antimicrobial and anti-inflammatory properties. The compound's structure suggests it may interact with biological systems, potentially serving as a lead compound in drug development. Its physical properties, such as melting point, boiling point, and solubility, would depend on the specific molecular interactions and the presence of functional groups. Overall, this compound is of interest in medicinal chemistry and may have applications in pharmaceuticals or agrochemicals.

Formula: C₁₂H₁₀NO₂S

InChI: InChI=1/C12H11NO2S/c1-8-3-2-4-9(5-8)12-13-10(7-16-12)6-11(14)15/h2-5,7H,6H2,1H3,(H,14,15)/p-1

SMILES: Cc1cccc(c1)c1nc(CC(=O)[O-])cs1

Synonyms:

• [2-(3-Methylphenyl)-1,3-Thiazol-4-Yl]Acetate

[2-(3-Methylphenyl)-1,3-thiazol-4-yl]acetic acid

CAS: 16441-29-5

Formula: C₁₂H₁₁NO₂S

Molecular weight: 233.2862

Ref: IN-DA001UVN