CAS 164461-18-1
:1-Pyrenylboronic acid
Description:
1-Pyrenylboronic acid is an organoboron compound characterized by the presence of a pyrene moiety, which is a polycyclic aromatic hydrocarbon, attached to a boronic acid functional group. This compound typically exhibits a high degree of fluorescence due to the pyrene structure, making it useful in various applications, including sensing and imaging. The boronic acid group allows for reversible interactions with diols, which is significant in biochemical applications, such as in the development of sensors for glucose and other carbohydrates. 1-Pyrenylboronic acid is generally soluble in organic solvents and can participate in various chemical reactions, including Suzuki coupling, which is a method for forming carbon-carbon bonds. Its unique properties make it valuable in materials science, organic synthesis, and medicinal chemistry. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and the presence of other functional groups, which is important for its application in complex biological systems.
Formula:C16H11BO2
InChI:InChI=1/C16H11BO2/c18-17(19)14-9-7-12-5-4-10-2-1-3-11-6-8-13(14)16(12)15(10)11/h1-9,18-19H
SMILES:c1cc2ccc3ccc(c4ccc(c1)c2c34)B(O)O
Synonyms:- Pyrene-1-Boronic Acid
- 1-Pyreneboronic Acid
- 1-Pyreneboronic Acid (contains varying amounts of Anhydride)
- 1-Pyreneboronic acid, 1-Pyrenylboronic acid
- Pyren-1-Ylboronic Acid
- 1-PYRENYLBORONIC ACID
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
1-Pyreneboronic Acid (contains varying amounts of Anhydride)
CAS:Formula:C16H11BO2Color and Shape:White to Light yellow to Light orange powder to crystalMolecular weight:246.07Pyrene-1-boronic acid, 95%
CAS:It is an important raw material and intermediate used in organic synthesis agrochemical, pharmaceutical and dyestuff field. Also used as a intermediate for organic light-emitting diode(OLED). This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. SomeFormula:C16H11BO2Purity:95%Molecular weight:246.07Boronic acid, B-1-pyrenyl-
CAS:Formula:C16H11BO2Purity:97%Color and Shape:SolidMolecular weight:246.0683Ref: IN-DA001UWE
1g22.00€5g40.00€10g59.00€25g87.00€50g137.00€100g179.00€250g575.00€1kg1,421.00€5kg6,927.00€Pyrene-1-boronic acid
CAS:Pyrene-1-boronic acidFormula:C16H11BO2Purity:97%Color and Shape:Pale yellow SolidMolecular weight:246.068341-Pyreneboronic Acid (contains varying amounts of Anhydride)
CAS:1-Pyreneboronic acid is a fluorescent derivative of boronic acid. It has been shown to have synergistic effects with other compounds, such as glucose monitoring. 1-Pyreneboronic acid is used in the preparation of a fluorescent probe for use in dna duplex assays. The fluorescence properties of this compound are affected by the presence of hydroxy groups and benzyl groups, making it useful for protein detection and identification. This compound can be prepared using the suzuki coupling reaction and it has been shown that it has an effect on cell line raw264.7 cells.
Formula:C16H11BO2Purity:Min. 95%Molecular weight:246.07 g/mol





