CAS 1646-54-4
:1,4-Dibromo-2,3,5,6-tetramethylbenzene
Description:
1,4-Dibromo-2,3,5,6-tetramethylbenzene, with the CAS number 1646-54-4, is an aromatic compound characterized by the presence of two bromine atoms and four methyl groups attached to a benzene ring. This compound features a symmetrical structure, with bromine substituents located at the 1 and 4 positions, while the methyl groups occupy the 2, 3, 5, and 6 positions. The presence of multiple methyl groups contributes to its hydrophobic nature and influences its physical properties, such as melting and boiling points, which are typically higher than those of simpler aromatic compounds. The bromine atoms enhance the compound's reactivity, making it useful in various chemical reactions, including nucleophilic substitutions. Additionally, 1,4-Dibromo-2,3,5,6-tetramethylbenzene can serve as an intermediate in organic synthesis and may exhibit interesting electronic properties due to its substituted aromatic system. Safety precautions should be taken when handling this compound, as brominated compounds can pose environmental and health risks.
Formula:C10H12Br2
InChI:InChI=1S/C10H12Br2/c1-5-6(2)10(12)8(4)7(3)9(5)11/h1-4H3
InChI key:InChIKey=IEWAQZBDJDWANM-UHFFFAOYSA-N
SMILES:BrC1=C(C)C(C)=C(Br)C(C)=C1C
Synonyms:- 1,4-Dibromotetramethylbenzene
- 3,6-Dibromo-1,2,4,5-tetramethylbenzene
- 3,6-Dibromodurene
- Benzene, 1,4-Dibromo-2,3,5,6-Tetramethyl-
- Dibromodurene
- NSC 87886
- 1,4-Dibromo-2,3,5,6-tetramethylbenzene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
1,4-Dibromo-2,3,5,6-tetramethylbenzene
CAS:Formula:C10H12Br2Purity:>98.0%(GC)Color and Shape:White to Almost white powder to crystalMolecular weight:292.011,4-Dibromo-2,3,5,6-tetramethylbenzene
CAS:1,4-Dibromo-2,3,5,6-tetramethylbenzeneFormula:C10H12Br2Purity:98%Molecular weight:292.0141,4-Dibromo-2,3,5,6-tetramethylbenzene
CAS:1,4-Dibromo-2,3,5,6-tetramethylbenzeneFormula:C10H12Br2Purity:97%Molecular weight:292.011,4-Dibromo-2,3,5,6-tetramethylbenzene
CAS:Formula:C10H12Br2Purity:95%Color and Shape:SolidMolecular weight:292.0141,4-Dibromo-2,3,5,6-tetramethylbenzene
CAS:1,4-Dibromo-2,3,5,6-tetramethylbenzene is a five-membered ring molecule with the chemical formula C8H8Br6. It has been shown to react with dichlorocarbene to form a 1:1 adduct, which is stable at room temperature and can be isolated as a crystalline solid. This compound has been used in the synthesis of perfluorinated compounds. The reaction rate of 1,4-dibromo-2,3,5,6-tetramethylbenzene is affected by electron donating or withdrawing groups on the methyl group. The compound has also been found to have inflammatory effects on diseases such as asthma and arthritis.
Formula:C10H12Br2Purity:Min. 95%Molecular weight:292.01 g/mol





