CAS 16461-71-5
:α-Azidobenzeneacetyl chloride
Description:
α-Azidobenzeneacetyl chloride, with the CAS number 16461-71-5, is an organic compound characterized by the presence of both an azide functional group and an acyl chloride. This compound typically appears as a colorless to pale yellow liquid and is known for its reactivity, particularly due to the presence of the acyl chloride group, which can readily participate in nucleophilic substitution reactions. The azide group contributes to its potential use in various synthetic applications, including the introduction of azide functionalities into other molecules through click chemistry. α-Azidobenzeneacetyl chloride is sensitive to moisture and should be handled with care, as it can hydrolyze in the presence of water, leading to the formation of hydrochloric acid and other byproducts. Its applications may extend to medicinal chemistry and materials science, where it can serve as an intermediate in the synthesis of more complex azide-containing compounds. Proper safety precautions are essential when working with this compound due to its reactive nature and potential hazards associated with azides.
Formula:C8H6ClN3O
InChI:InChI=1S/C8H6ClN3O/c9-8(13)7(11-12-10)6-4-2-1-3-5-6/h1-5,7H
InChI key:InChIKey=NRSMVAFUFMOXFI-UHFFFAOYSA-N
SMILES:C(N=[N+]=[N-])(C(Cl)=O)C1=CC=CC=C1
Synonyms:- (±)-α-Azidobenzeneacetyl chloride
- Acetyl chloride, azidophenyl-
- Azido(Phenyl)Acetyl Chloride
- Benzeneacetyl chloride, α-azido-
- Phenylazidoacetyl chloride
- α-Azidophenylacetyl chloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
