CAS 164656-20-6
:(3S,3aS,5aS,6R,9aS,9bS)-3-[[[2,5-Bis(trifluoromethyl)phenyl]amino]carbonyl]dodecahydro-3a,6-dimethyl-7-oxo-1H-benz[e]indene-6-propanoic acid
Description:
The chemical substance with the name "(3S,3aS,5aS,6R,9aS,9bS)-3-[[[2,5-Bis(trifluoromethyl)phenyl]amino]carbonyl]dodecahydro-3a,6-dimethyl-7-oxo-1H-benz[e]indene-6-propanoic acid" and CAS number "164656-20-6" is a complex organic compound characterized by its multi-ring structure and specific stereochemistry. It features a dodecahydrobenz[e]indene core, which contributes to its unique three-dimensional shape and potential biological activity. The presence of a trifluoromethyl group enhances its lipophilicity and may influence its interaction with biological targets. Additionally, the amino and carbonyl functional groups suggest potential reactivity and solubility characteristics, making it of interest in medicinal chemistry. The compound's stereochemical configuration indicates that it may exhibit specific interactions with biological receptors, potentially leading to varied pharmacological effects. Overall, this substance exemplifies the intricate relationship between molecular structure and biological activity, making it a candidate for further research in drug development and therapeutic applications.
Formula:C27H31F6NO4
InChI:InChI=1S/C27H31F6NO4/c1-24-11-9-17-15(4-8-21(35)25(17,2)12-10-22(36)37)16(24)6-7-19(24)23(38)34-20-13-14(26(28,29)30)3-5-18(20)27(31,32)33/h3,5,13,15-17,19H,4,6-12H2,1-2H3,(H,34,38)(H,36,37)/t15-,16-,17-,19+,24-,25+/m0/s1
InChI key:InChIKey=MBYIOMUJPQFEQG-ULLAOQFFSA-N
SMILES:C[C@@]12[C@]([C@]3([C@@]([C@](CCC(O)=O)(C)C(=O)CC3)(CC1)[H])[H])(CC[C@@H]2C(NC4=C(C(F)(F)F)C=CC(C(F)(F)F)=C4)=O)[H]
Synonyms:- (3S,3aS,5aS,6R,9aS,9bS)-3-[[[2,5-Bis(trifluoromethyl)phenyl]amino]carbonyl]dodecahydro-3a,6-dimethyl-7-oxo-1H-benz[e]indene-6-propanoic acid
- 1H-Benz[e]indene-6-propanoic acid, 3-[[[2,5-bis(trifluoromethyl)phenyl]amino]carbonyl]dodecahydro-3a,6-dimethyl-7-oxo-, [3S-(3α,3aα,5aβ,6β,9aα,9bβ)]-
- 1H-Benz[e]indene-6-propanoic acid, 3-[[[2,5-bis(trifluoromethyl)phenyl]amino]carbonyl]dodecahydro-3a,6-dimethyl-7-oxo-, (3S,3aS,5aS,6R,9aS,9bS)-
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
