CAS 1646629-09-5

10H-Phenothiazine, 10-(4-bromophenyl)-, 5,5-dioxide

Description:

10H-Phenothiazine, 10-(4-bromophenyl)-, 5,5-dioxide, identified by its CAS number 1646629-09-5, is a synthetic organic compound belonging to the phenothiazine class. This compound features a phenothiazine core structure, which consists of a sulfur atom and a nitrogen atom within a three-ring system, contributing to its unique chemical properties. The presence of the 4-bromophenyl substituent enhances its reactivity and potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The 5,5-dioxide functional group indicates the presence of two carbonyl oxygen atoms, which can influence the compound's electronic properties and solubility. Typically, compounds of this nature exhibit biological activity, making them of interest in the fields of pharmacology and toxicology. Additionally, the bromine substituent may impart specific characteristics such as increased lipophilicity or altered binding affinity to biological targets. Overall, this compound's structural features suggest potential utility in various chemical and biological applications.

Formula: C₁₈H₁₂BrNO₂S

InChI: InChI=1S/C18H12BrNO2S/c19-13-9-11-14(12-10-13)20-15-5-1-3-7-17(15)23(21,22)18-8-4-2-6-16(18)20/h1-12H

InChI key: USRGMGIWTHXVKQ-UHFFFAOYSA-N

SMILES: C1=CC=C2C(=C1)N(C3=CC=CC=C3S2(=O)=O)C4=CC=C(C=C4)Br

Synonyms:

• 10-(4-bromophenyl)-10H-phenothiazine 5,5-dioxide
• 10H-Phenothiazine, 10-(4-bromophenyl)-, 5,5-dioxide

10-(4-Bromophenyl)-10H-phenothiazine 5,5-dioxide

CAS: 1646629-09-5

10-(4-Bromophenyl)-10H-phenothiazine 5,5-dioxide

Formula: C₁₈H₁₂BrNO₂S

Purity: 98%

Molecular weight: 386.27

Ref: 54-OR1062068

10-(4-Bromophenyl)-10H-phenothiazine 5,5-dioxide

CAS: 1646629-09-5

Formula: C₁₈H₁₂BrNO₂S

Purity: 95%

Color and Shape: Solid

Molecular weight: 386.2624

Ref: IN-DA02CRYD