CymitQuimica logo

CAS 164667-56-5

:

Methyl 2-formyl-4-methyl-4H-furo[3,2-b]pyrrole-5-carboxylate

Description:
Methyl 2-formyl-4-methyl-4H-furo[3,2-b]pyrrole-5-carboxylate is a complex organic compound characterized by its unique fused heterocyclic structure, which includes both furan and pyrrole rings. This compound typically exhibits a range of functional groups, including an aldehyde, a carboxylate ester, and a methyl group, contributing to its reactivity and potential applications in organic synthesis. It is often used in the development of pharmaceuticals and agrochemicals due to its ability to participate in various chemical reactions, such as condensation and cycloaddition. The presence of the furo and pyrrole moieties may impart interesting electronic properties, making it a candidate for studies in materials science and medicinal chemistry. Additionally, the compound's solubility and stability can vary depending on the solvent and environmental conditions, which are important considerations for its practical applications. Overall, Methyl 2-formyl-4-methyl-4H-furo[3,2-b]pyrrole-5-carboxylate is a noteworthy substance in the realm of organic chemistry with potential utility in various fields.
Formula:C10H9NO4
InChI:InChI=1S/C10H9NO4/c1-11-7-3-6(5-12)15-9(7)4-8(11)10(13)14-2/h3-5H,1-2H3
InChI key:InChIKey=VUQKFEPTRLQDRG-UHFFFAOYSA-N
SMILES:CN1C2=C(C=C1C(OC)=O)OC(C=O)=C2
Synonyms:
  • 4H-Furo[3,2-b]pyrrole-5-carboxylic acid, 2-formyl-4-methyl-, methyl ester
  • Methyl 2-formyl-4-methyl-4H-furo[3,2-b]pyrrole-5-carboxylate
Found 3 products.