CymitQuimica logo

CAS 16473-11-3

:

bicyclo(3.3.1)nonane-2,6-dione

Description:
Bicyclo(3.3.1)nonane-2,6-dione, with the CAS number 16473-11-3, is a bicyclic organic compound characterized by its unique structural framework, which consists of two fused cyclopropane rings and a ketone functional group at the 2 and 6 positions. This compound exhibits a non-linear, three-dimensional conformation, contributing to its distinct chemical properties. The presence of the diketone functional groups suggests that it may participate in various chemical reactions, including nucleophilic additions and condensation reactions. Bicyclo(3.3.1)nonane-2,6-dione is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its reactivity can be influenced by the strain in the bicyclic structure, which can lead to interesting chemical behavior. Additionally, compounds with similar bicyclic frameworks are often studied for their potential applications in organic synthesis and materials science. Overall, this compound represents a fascinating area of study within the field of organic chemistry due to its unique structure and reactivity.
Formula:C9H12O2
InChI:InChI=1/C9H12O2/c10-8-3-1-6-5-7(8)2-4-9(6)11/h6-7H,1-5H2/t6-,7-/m1/s1
InChI key:QWNPVTXLBMSEPN-UHFFFAOYSA-N
SMILES:C1CC(=O)[C@@H]2CCC(=O)[C@H]1C2
Synonyms:
  • (1R,5R)-bicyclo[3.3.1]nonane-2,6-dione
  • Bicyclo[3.3.1]nonane-2,6-dione
Found 4 products.