CymitQuimica logo

CAS 16496-38-1

:

Pentaric acid, 2,3-dideoxy-3-(methoxycarbonyl)-, 1,4-lactone, 5-methyl ester

Description:
Pentaric acid, 2,3-dideoxy-3-(methoxycarbonyl)-, 1,4-lactone, 5-methyl ester, identified by CAS number 16496-38-1, is a chemical compound that belongs to the class of lactones, which are cyclic esters formed from the condensation of hydroxy acids. This compound features a unique structure characterized by the presence of a methoxycarbonyl group and a methyl ester, contributing to its reactivity and potential applications in organic synthesis. The lactone structure indicates that it may exhibit properties typical of cyclic compounds, such as increased stability and specific reactivity patterns. Additionally, the presence of dideoxy and methyl substituents suggests that it may have interesting biological activities or serve as a precursor in the synthesis of more complex molecules. Its solubility, melting point, and other physical properties would depend on the specific conditions and solvent used. Overall, this compound may be of interest in medicinal chemistry and the development of pharmaceuticals due to its structural features.
Formula:C8H10O6
InChI:InChI=1S/C8H10O6/c1-12-7(10)4-3-5(9)14-6(4)8(11)13-2/h4,6H,3H2,1-2H3
InChI key:InChIKey=ZTQAVXKHIVFJHN-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1C(C(OC)=O)OC(=O)C1
Synonyms:
  • Isocitric acid, γ-lactone, dimethyl ester
  • Pentaric acid, 2,3-dideoxy-3-(methoxycarbonyl)-, 1,4-lactone, 5-methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.