
CAS 164982-41-6
:N-Hydroxy-5-isoxazolecarboximidamide
Description:
N-Hydroxy-5-isoxazolecarboximidamide, with the CAS number 164982-41-6, is a chemical compound characterized by its unique isoxazole ring structure, which contributes to its reactivity and potential biological activity. This compound features a hydroxylamine functional group, which is known for its ability to form stable complexes with various metal ions and participate in nucleophilic reactions. The presence of the carboximidamide moiety enhances its potential as a bioactive agent, possibly influencing enzyme activity or serving as a precursor in synthetic pathways. N-Hydroxy-5-isoxazolecarboximidamide may exhibit properties such as solubility in polar solvents and stability under specific conditions, making it of interest in medicinal chemistry and pharmaceutical research. Its specific applications and mechanisms of action would depend on further studies, particularly in the context of its interactions with biological systems. Overall, this compound represents a fascinating area of study within organic and medicinal chemistry, with potential implications for drug development and therapeutic applications.
Formula:C4H5N3O2
InChI:InChI=1S/C4H5N3O2/c5-4(7-8)3-1-2-6-9-3/h1-2,8H,(H2,5,7)
InChI key:InChIKey=NKDDHOVYAFKMBE-UHFFFAOYSA-N
SMILES:C(NO)(=N)C1=CC=NO1
Synonyms:- N-Hydroxy-5-isoxazolecarboximidamide
- 5-Isoxazolecarboximidamide, N-hydroxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
