CAS 16499-68-6
:Benzamide, 2-nitro-5-(trifluoromethyl)-
Description:
Benzamide, 2-nitro-5-(trifluoromethyl)-, is an organic compound characterized by the presence of a benzamide functional group, which consists of a benzene ring attached to a carbonyl group (C=O) and an amine (NH2). The compound features a nitro group (-NO2) and a trifluoromethyl group (-CF3) at specific positions on the benzene ring, contributing to its unique chemical properties. The presence of the nitro group typically enhances the compound's reactivity, making it a potential candidate for various chemical reactions, including electrophilic aromatic substitution. The trifluoromethyl group is known for imparting lipophilicity and influencing the compound's electronic properties. This compound is likely to exhibit moderate solubility in organic solvents and may have applications in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis. Its specific physical properties, such as melting point and boiling point, would depend on the molecular interactions and the overall structure. Safety data should be consulted for handling and potential hazards associated with this compound.
Formula:C8H5F3N2O3
InChI:InChI=1S/C8H5F3N2O3/c9-8(10,11)4-1-2-6(13(15)16)5(3-4)7(12)14/h1-3H,(H2,12,14)
InChI key:InChIKey=CKYMCTVRKADRLC-UHFFFAOYSA-N
SMILES:C(N)(=O)C1=C(N(=O)=O)C=CC(C(F)(F)F)=C1
Synonyms:- m-Toluamide, α,α,α-trifluoro-6-nitro-
- Benzamide, 2-nitro-5-(trifluoromethyl)-
- 2-Nitro-5-(trifluoromethyl)benzamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
