CAS 16500-53-1
:O,O-diethyl S-(3,4,4-trifluorobut-2-en-1-yl) phosphorodithioate
Description:
O,O-Diethyl S-(3,4,4-trifluorobut-2-en-1-yl) phosphorodithioate, with CAS number 16500-53-1, is an organophosphorus compound characterized by its phosphorodithioate functional group. This substance features a phosphorus atom bonded to two ethyl groups and a thiol group, which contributes to its reactivity and potential biological activity. The presence of the trifluorobut-2-en-1-yl moiety introduces significant steric and electronic effects due to the electronegative fluorine atoms, which can influence the compound's chemical behavior and interactions. Typically, compounds of this class are known for their use in agricultural applications, particularly as pesticides or insecticides, due to their ability to inhibit acetylcholinesterase, an essential enzyme in nerve function. The stability, solubility, and toxicity of this compound can vary based on environmental conditions and its specific formulation. Safety measures should be observed when handling such chemicals, given their potential for harmful effects on non-target organisms and the environment.
Formula:C8H14F3O2PS2
InChI:InChI=1/C8H14F3O2PS2/c1-3-12-14(15,13-4-2)16-6-5-7(9)8(10)11/h5,8H,3-4,6H2,1-2H3
SMILES:CCOP(=S)(OCC)SCC=C(C(F)F)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Phosphorodithioic acid, O,O-diethyl S-(3,4,4-trifluoro-3-buten-1-yl) ester
CAS:Formula:C8H14F3O2PS2Molecular weight:294.2945
