CymitQuimica logo

CAS 16503-77-8

:

difluoro(phenylsulfanyl)acetyl chloride

Description:
Difluoro(phenylsulfanyl)acetyl chloride is an organofluorine compound characterized by the presence of both fluorine atoms and a phenylsulfanyl group attached to an acetyl chloride moiety. This compound typically exhibits a molecular structure that includes a carbonyl group (C=O) adjacent to a chlorine atom, which contributes to its reactivity, particularly in nucleophilic substitution reactions. The presence of the difluoro substituents enhances its electrophilic character, making it a useful intermediate in organic synthesis, especially in the preparation of pharmaceuticals and agrochemicals. The phenylsulfanyl group introduces additional reactivity and can participate in various chemical transformations. As a chlorinated compound, it may also pose certain hazards, including toxicity and potential environmental impacts, necessitating careful handling and storage. Overall, difluoro(phenylsulfanyl)acetyl chloride is a valuable compound in synthetic organic chemistry, with applications that leverage its unique chemical properties.
Formula:C8H5ClF2OS
InChI:InChI=1/C8H5ClF2OS/c9-7(12)8(10,11)13-6-4-2-1-3-5-6/h1-5H
SMILES:c1ccc(cc1)SC(C(=O)Cl)(F)F
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.