
CAS 165059-43-8
:4,4,5,5-Tetramethyl-2-[(1E)-3-[2-(trimethylsilyl)ethoxy]-1-propen-1-yl]-1,3,2-dioxaborolane
Description:
4,4,5,5-Tetramethyl-2-[(1E)-3-[2-(trimethylsilyl)ethoxy]-1-propen-1-yl]-1,3,2-dioxaborolane is a boron-containing organic compound characterized by its unique structure, which includes a dioxaborolane ring and a propenyl substituent. This compound features a boron atom bonded to two oxygen atoms in a cyclic arrangement, contributing to its stability and reactivity. The presence of the trimethylsilyl group enhances its solubility and volatility, making it useful in various synthetic applications. The compound is typically used in organic synthesis, particularly in reactions involving boron chemistry, such as cross-coupling reactions. Its functional groups allow for selective reactivity, making it a valuable intermediate in the synthesis of more complex molecules. Additionally, the steric hindrance provided by the tetramethyl groups can influence its reactivity and selectivity in chemical reactions. Overall, this compound is significant in the field of organic chemistry, particularly in the development of new synthetic methodologies.
Formula:C14H29BO3Si
InChI:InChI=1S/C14H29BO3Si/c1-13(2)14(3,4)18-15(17-13)9-8-10-16-11-12-19(5,6)7/h8-9H,10-12H2,1-7H3/b9-8+
InChI key:InChIKey=RKBMJNHYBXZSLL-CMDGGOBGSA-N
SMILES:C(=C/COCC[Si](C)(C)C)\B1OC(C)(C)C(C)(C)O1
Synonyms:- 1,3,2-Dioxaborolane, 4,4,5,5-tetramethyl-2-[(1E)-3-[2-(trimethylsilyl)ethoxy]-1-propenyl]-
- 1,3,2-Dioxaborolane, 4,4,5,5-tetramethyl-2-[(1E)-3-[2-(trimethylsilyl)ethoxy]-1-propen-1-yl]-
- 4,4,5,5-Tetramethyl-2-[(1E)-3-[2-(trimethylsilyl)ethoxy]-1-propen-1-yl]-1,3,2-dioxaborolane
- 1,3,2-Dioxaborolane, 4,4,5,5-tetramethyl-2-[3-[2-(trimethylsilyl)ethoxy]-1-propenyl]-, (E)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1,3,2-Dioxaborolane, 4,4,5,5-tetramethyl-2-[(1E)-3-[2-(trimethylsilyl)ethoxy]-1-propen-1-yl]-
CAS:Formula:C14H29BO3SiMolecular weight:284.2748
