
CAS 165173-47-7
:Docetaxel Impurity 12
Description:
Docetaxel Impurity 12, identified by its CAS number 165173-47-7, is a chemical compound associated with the pharmaceutical agent docetaxel, which is used primarily in cancer treatment. As an impurity, it is typically a byproduct of the synthesis of docetaxel and may arise during the manufacturing process. The characteristics of this compound include its molecular structure, which is related to the taxane family, and it may exhibit similar physical and chemical properties to docetaxel, such as solubility in organic solvents and stability under specific conditions. Impurities like Docetaxel Impurity 12 are often characterized by their potential effects on the efficacy and safety of the primary drug, making their identification and quantification important in pharmaceutical quality control. Analytical techniques such as HPLC (High-Performance Liquid Chromatography) and mass spectrometry are commonly employed to detect and analyze such impurities. Understanding the characteristics of impurities is crucial for ensuring the purity and safety of pharmaceutical products.
Formula:C29H36O10
InChI:InChI=1S/C29H36O10/c1-14-17(31)12-29(36)24(38-25(35)16-9-7-6-8-10-16)22-27(5,23(34)21(33)20(14)26(29,3)4)18(32)11-19-28(22,13-37-19)39-15(2)30/h6-10,17-19,21-22,24,31-33,36H,11-13H2,1-5H3/t17-,18-,19+,21-,22-,24-,27+,28-,29+/m0/s1
InChI key:YWLXLRUDGLRYDR-RORZEMHPSA-N
SMILES:CC1=C2[C@@H](C(=O)[C@@]3([C@H](C[C@@H]4[C@]([C@H]3[C@@H]([C@@](C2(C)C)(C[C@@H]1O)O)OC(=O)C5=CC=CC=C5)(CO4)OC(=O)C)O)C)O
Synonyms:- (2aR,4S,4aS,6S,9S,11S,12S,12aR,12bS)-12b-acetoxy-4,6,9,11-tetrahydroxy-4a,8,13,13-tetramethyl-5-oxo-2a,3,4,4a,5,6,9,10,11,12,12a,12b-dodecahydro-1H-7,11-methanocyclodeca[3,4]benzo[1,2-b]oxet-12-yl benzoate
- Docetaxel Impurity 12
- 7,11-Methano-5H-cyclodeca[3,4]benz[1,2-b]oxet-5-one, 12b-(acetyloxy)-12-(benzoyloxy)-1,2a,3,4,4a,6,9,10,11,12,12a,12b-dodecahydro-4,6,9,11-tetrahydroxy-4a,8,13,13-tetramethyl-, (2aR,4S,4aS,6S,9S,11S,12S,12aR,12bS)-
- Docetaxel Impurity 53
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.

