CAS 16523-31-2
:1,3-Benzenediol, 4,6-diamino-, hydrochloride (1:2)
Description:
1,3-Benzenediol, 4,6-diamino-, hydrochloride (1:2), also known as 4,6-diamino-1,3-benzenediol hydrochloride, is a chemical compound characterized by its aromatic structure featuring two hydroxyl groups and two amino groups. This compound is typically encountered as a hydrochloride salt, which enhances its solubility in water. It is often used in various applications, including as an intermediate in the synthesis of dyes, pharmaceuticals, and other organic compounds. The presence of both amino and hydroxyl functional groups contributes to its reactivity, allowing it to participate in various chemical reactions, such as nucleophilic substitutions and coupling reactions. Additionally, the compound may exhibit biological activity, making it of interest in medicinal chemistry. Safety data should be consulted for handling, as the compound may pose health risks if ingested or inhaled. Overall, 1,3-benzenediol, 4,6-diamino-, hydrochloride is a versatile compound with significant utility in chemical synthesis and potential applications in various fields.
Formula:C6H8N2O2·2ClH
InChI:InChI=1S/C6H8N2O2.2ClH/c7-3-1-4(8)6(10)2-5(3)9;;/h1-2,9-10H,7-8H2;2*1H
InChI key:InChIKey=KUMOYHHELWKOCB-UHFFFAOYSA-N
SMILES:NC1=C(O)C=C(O)C(N)=C1.Cl
Synonyms:- 1,3-Benzenediol, 4,6-diamino-, dihydrochloride
- 1,3-Benzenediol, 4,6-diamino-, hydrochloride (1:2)
- 1,3-Diamino-4,6-dihydroxybenzene dihydrochloride
- 4,6-Diamino-1,3-benzenediol dihydrochloride
- 4,6-Diamino-1,3-dihydroxybenzene dihydrochloride
- 4,6-Diaminoresocinol dihydrochloride
- 4,6-Diaminoresorcin dihydrochloride
- 4,6-Diaminoresorcinol dihydrochloride
- 6-Dihydroxy-m-phenylenediamine dihydrochloride
- Dihydroxy-m-phenylenediamine Dihydrochloride
- Resorcinol, 4,6-diamino-, dihydrochloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
1,3-Benzenediol, 4,6-diamino-, hydrochloride (1:2)
CAS:Formula:C6H10Cl2N2O2Purity:98%Color and Shape:SolidMolecular weight:213.06184,6-Diaminobenzene-1,3-diol dihydrochloride
CAS:4,6-Diaminobenzene-1,3-diol dihydrochloridePurity:98%Molecular weight:213.06g/mol4,6-Diaminoresorcinol Dihydrochloride
CAS:Formula:C6H8N2O2·2HClPurity:>98.0%(T)(N)Color and Shape:White to Light yellow to Light orange powder to crystalMolecular weight:213.064,6-Diaminoresorcinol dihydrochloride
CAS:4,6-Diaminoresorcinol dihydrochloride is a white solid that has viscosity and hydrochloric acid as its structural formula. It is soluble in water and reacts with proton, monosodium salt to form a precipitate. 4,6-Diaminoresorcinol dihydrochloride reacts with phosphorus pentoxide to form the sulfonation product. The thermal expansion of this material is 2.8 x 10^-5/K and it has shown chemical stability at high temperatures up to 450°C. This compound has been found to be an element analysis for chloride (Cl), hydrogen chloride (HCl) and morphology.Formula:C6H10N2O2Cl2Purity:Min. 98 Area-%Molecular weight:213.06 g/mol4,6-Diaminobenzene-1,3-diol dihydrochloride
CAS:Formula:C6H10Cl2N2O2Purity:97.0%Color and Shape:SolidMolecular weight:213.06




