CAS 165258-70-8
:2,4-Pyrimidinediamine, 6-fluoro-N4,N4-dimethyl-
Description:
2,4-Pyrimidinediamine, 6-fluoro-N4,N4-dimethyl- is a chemical compound characterized by its pyrimidine ring structure, which is a six-membered aromatic ring containing two nitrogen atoms at the 2 and 4 positions. The presence of a fluorine atom at the 6 position and dimethyl groups at the N4 positions contributes to its unique reactivity and potential applications. This compound is typically a solid at room temperature and may exhibit properties such as solubility in polar solvents, depending on its specific functional groups. It is often studied for its biological activity, particularly in the context of pharmaceuticals, where modifications to the pyrimidine structure can influence its interaction with biological targets. Safety data sheets should be consulted for handling and toxicity information, as compounds with similar structures can vary widely in their safety profiles. Overall, 2,4-Pyrimidinediamine, 6-fluoro-N4,N4-dimethyl- represents a class of compounds with significant interest in medicinal chemistry and drug development.
Formula:C6H9FN4
InChI:InChI=1/C6H9FN4/c1-11(2)5-3-4(7)9-6(8)10-5/h3H,1-2H3,(H2,8,9,10)
SMILES:CN(C)c1cc(F)[nH]c(=N)n1
Synonyms:- 6-Fluoro-N4,N4-dimethyl-2,4-pyrimidinediamine
- 6-fluoro-N~4~,N~4~-dimethylpyrimidine-2,4-diamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
