CAS 1653-34-5
:(±)-2-Pentadecanol
Description:
(±)-2-Pentadecanol, with the CAS number 1653-34-5, is a long-chain fatty alcohol characterized by its hydrophobic nature due to the lengthy hydrocarbon chain, which consists of 15 carbon atoms. This compound features a hydroxyl (-OH) functional group located on the second carbon of the chain, contributing to its classification as a secondary alcohol. The presence of the hydroxyl group imparts some degree of polarity, allowing for limited solubility in water while enhancing solubility in organic solvents. (±)-2-Pentadecanol is typically a waxy solid at room temperature and has applications in various industries, including cosmetics, pharmaceuticals, and as a surfactant. Its chiral nature means it exists as a racemic mixture, containing both enantiomers, which may exhibit different biological activities. Additionally, the compound can undergo typical alcohol reactions, such as oxidation to form ketones or aldehydes, and can participate in esterification reactions with acids to produce esters. Overall, (±)-2-Pentadecanol is notable for its structural properties and versatility in chemical applications.
Formula:C15H32O
InChI:InChI=1S/C15H32O/c1-3-4-5-6-7-8-9-10-11-12-13-14-15(2)16/h15-16H,3-14H2,1-2H3
InChI key:InChIKey=ALVGHPMGQNBJRC-UHFFFAOYSA-N
SMILES:C(CCCCCCCC)CCCCC(C)O
Synonyms:- NSC 86160
- 2-Pentadecanol
- sec-Pentadecyl alcohol
- (±)-2-Pentadecanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
