CAS 165331-08-8: (2R,3S,4S,5S,6S)-2-(2-azidoethoxy)-6-(hydroxymethyl)tetrahydropyran-3,4,5-triol
Description:The chemical substance known as "(2R,3S,4S,5S,6S)-2-(2-azidoethoxy)-6-(hydroxymethyl)tetrahydropyran-3,4,5-triol," with the CAS number 165331-08-8, is a complex organic compound characterized by its tetrahydropyran ring structure, which is a six-membered cyclic ether. This compound features multiple hydroxyl groups, indicating it is a polyol, which contributes to its hydrophilicity and potential reactivity in various chemical environments. The presence of an azido group (-N3) suggests that it may participate in click chemistry reactions, making it useful in bioconjugation and material science applications. The stereochemistry, denoted by the (2R,3S,4S,5S,6S) configuration, indicates specific spatial arrangements of its substituents, which can significantly influence its biological activity and interactions. Overall, this compound's unique functional groups and stereochemistry make it a candidate for further research in medicinal chemistry and synthetic applications.
Formula:C8H15N3O6
InChI:InChI=1/C8H15N3O6/c9-11-10-1-2-16-8-7(15)6(14)5(13)4(3-12)17-8/h4-8,12-15H,1-3H2/t4-,5+,6-,7-,8+/m0/s1
- Synonyms:
- 2-Azidoethyl α-L-gulopyranoside
- α-L-gulopyranoside, 2-azidoethyl
