CAS 165331-08-8
:(2R,3S,4S,5S,6S)-2-(2-azidoethoxy)-6-(hydroxymethyl)tetrahydropyran-3,4,5-triol
Description:
The chemical substance known as "(2R,3S,4S,5S,6S)-2-(2-azidoethoxy)-6-(hydroxymethyl)tetrahydropyran-3,4,5-triol," with the CAS number 165331-08-8, is a complex organic compound characterized by its tetrahydropyran ring structure, which is a six-membered cyclic ether. This compound features multiple hydroxyl groups, indicating it is a polyol, which contributes to its hydrophilicity and potential reactivity in various chemical environments. The presence of an azido group (-N3) suggests that it may participate in click chemistry reactions, making it useful in bioconjugation and material science applications. The stereochemistry, denoted by the (2R,3S,4S,5S,6S) configuration, indicates specific spatial arrangements of its substituents, which can significantly influence its biological activity and interactions. Overall, this compound's unique functional groups and stereochemistry make it a candidate for further research in medicinal chemistry and synthetic applications.
Formula:C8H15N3O6
InChI:InChI=1/C8H15N3O6/c9-11-10-1-2-16-8-7(15)6(14)5(13)4(3-12)17-8/h4-8,12-15H,1-3H2/t4-,5+,6-,7-,8+/m0/s1
Synonyms:- 2-Azidoethyl α-L-gulopyranoside
- α-L-gulopyranoside, 2-azidoethyl
- 2-Azidoethyl β-D-Glucopyranoside >
- 2-Azidoethyl β-D-Glucopyranoside
- 2-Azidoethyl beta-D-Glucopyranoside
- 2-Azidoethyl &beta
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
2-Azidoethyl β-D-Glucopyranoside
CAS:Formula:C8H15N3O6Purity:>98.0%(HPLC)Color and Shape:Colorless to Almost colorless clear liquidMolecular weight:249.222-Azidoethyl β-D-Glucopyranoside
CAS:Formula:C8H15N3O6Purity:98.0%Color and Shape:LiquidMolecular weight:249.22122-Azidoethyl β-D-glucopyranoside
CAS:2-Azidoethyl β-D-glucopyranosideFormula:C8H15N3O6Molecular weight:249.22122-Azidoethyl β-D-Glucopyranoside
CAS:2-Azidoethyl β-D-Glucopyranoside is a high-purity click chemistry reagent for CuAAC or SPAAC bioconjugation, facilitating chemical biology, material science, and biomaterial studies.Formula:C8H15N3O6Molecular weight:249.222-Azidoethyl ²-D-Glucopyranoside
CAS:2-Azidoethyl ²-D-Glucopyranoside is a versatile building block that can be used as an intermediate for the synthesis of complex compounds. It is also used as a reaction component and speciality chemical in research, and has been shown to be useful in the synthesis of fine chemicals. This compound is a high quality reagent with CAS No. 165331-08-8 and can be used as a building block for the synthesis of other compounds.
Formula:C8H15N3O6Purity:Min. 95%Color and Shape:PowderMolecular weight:249.22(diazyn-1-ium-1-yl)(2-{[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}ethyl)azanide
CAS:Purity:98%Molecular weight:249.2230072







