CymitQuimica logo

CAS 16536-57-5

:

rel-(1R,2S)-2-Bromocyclohexanol

Description:
Rel-(1R,2S)-2-Bromocyclohexanol is a chiral organic compound characterized by the presence of a bromine atom and a hydroxyl group attached to a cyclohexane ring. The "rel" prefix indicates that the compound has a specific stereochemistry, with the (1R,2S) configuration denoting the spatial arrangement of the substituents around the chiral centers. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is soluble in organic solvents and exhibits moderate polarity due to the hydroxyl group. The presence of the bromine atom makes it a potential electrophile, which can participate in various chemical reactions, including nucleophilic substitutions. The compound is of interest in organic synthesis and may serve as an intermediate in the preparation of other chemical entities. Additionally, its stereochemistry can influence its reactivity and interactions in biological systems, making it relevant in medicinal chemistry and pharmacology. Safety precautions should be observed when handling this compound due to its potential toxicity and reactivity.
Formula:C6H11BrO
InChI:InChI=1/C6H11BrO/c7-5-3-1-2-4-6(5)8/h5-6,8H,1-4H2/t5-,6+/s2
InChI key:InChIKey=AAMCLCZHZXKWRV-MZQZIECVNA-N
SMILES:Br[C@H]1[C@@H](O)CCCC1
Synonyms:
  • cis-2-Bromocyclohexanol
  • Cyclohexanol, 2-bromo-, (1R,2S)-rel-
  • Cyclohexanol, 2-bromo-, cis-
  • rel-(1R,2S)-2-Bromocyclohexanol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.