
CAS 16545-00-9
:1,6-Bis[2-(diethylamino)ethyl] hexanedioate
Description:
1,6-Bis[2-(diethylamino)ethyl] hexanedioate, with the CAS number 16545-00-9, is a chemical compound characterized by its structure, which features a hexanedioate backbone with two diethylaminoethyl substituents. This compound is typically classified as an amine derivative and is known for its potential applications in various fields, including pharmaceuticals and materials science. The presence of diethylamino groups suggests that it may exhibit basic properties and can participate in various chemical reactions, such as nucleophilic substitutions. Additionally, the hexanedioate moiety indicates that it may have applications as a diacid or in the synthesis of polyesters. The compound's solubility, stability, and reactivity can be influenced by the presence of the diethylamino groups, which can enhance its interaction with other chemical species. Overall, 1,6-Bis[2-(diethylamino)ethyl] hexanedioate is a versatile compound with potential utility in synthetic chemistry and material development.
Formula:C18H36N2O4
InChI:InChI=1S/C18H36N2O4/c1-5-19(6-2)13-15-23-17(21)11-9-10-12-18(22)24-16-14-20(7-3)8-4/h5-16H2,1-4H3
InChI key:InChIKey=RGAMPJYGTCSRAG-UHFFFAOYSA-N
SMILES:N(CCOC(CCCCC(OCCN(CC)CC)=O)=O)(CC)CC
Synonyms:- Adipic acid, bis[2-(diethylamino)ethyl] ester
- Hexanedioic acid, bis[2-(diethylamino)ethyl] ester
- 1,6-Bis[2-(diethylamino)ethyl] hexanedioate
- Hexanedioic acid, 1,6-bis[2-(diethylamino)ethyl] ester
- Diethylethanolamine-adipic acid diester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Hexanedioic acid, 1,6-bis[2-(diethylamino)ethyl] ester
CAS:Formula:C18H36N2O4Molecular weight:344.4894
