CAS 1655-66-9
:N,N-Bis(2,4-dinitrophenyl)-L-histidine
Description:
N,N-Bis(2,4-dinitrophenyl)-L-histidine, identified by its CAS number 1655-66-9, is a chemical compound that features a histidine backbone modified with two 2,4-dinitrophenyl groups. This compound is characterized by its potential use in biochemical applications, particularly in the study of enzyme activity and protein interactions due to the presence of the dinitrophenyl moieties, which can serve as effective chromophores. The histidine component contributes to its ability to participate in various chemical reactions, including coordination with metal ions and involvement in acid-base chemistry. The compound is typically synthesized through a coupling reaction involving L-histidine and dinitrophenyl derivatives. Its properties include solubility in organic solvents and potential reactivity with nucleophiles, making it a useful reagent in organic synthesis and analytical chemistry. Additionally, due to the presence of nitro groups, it may exhibit significant biological activity, which warrants careful handling and consideration of safety protocols during use.
Formula:C18H13N7O10
InChI:InChI=1S/C18H13N7O10/c26-18(27)17(5-10-8-19-9-20-10)21(13-3-1-11(22(28)29)6-15(13)24(32)33)14-4-2-12(23(30)31)7-16(14)25(34)35/h1-4,6-9,17H,5H2,(H,19,20)(H,26,27)/t17-/m0/s1
InChI key:InChIKey=DYPVFKXVTXSSTH-KRWDZBQOSA-N
SMILES:N([C@@H](CC1=CN=CN1)C(O)=O)(C2=C(N(=O)=O)C=C(N(=O)=O)C=C2)C3=C(N(=O)=O)C=C(N(=O)=O)C=C3
Synonyms:- Histidine, N,N-bis(2,4-dinitrophenyl)-
- N,N-Bis(2,4-dinitrophenyl)-L-histidine
- L-Histidine, N,N-bis(2,4-dinitrophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
