
CAS 1655-70-5
:1,1′-Oxybis[2-methoxybenzene]
Description:
1,1′-Oxybis[2-methoxybenzene], also known as bis(2-methoxyphenyl) ether, is an organic compound characterized by its ether functional group linking two methoxy-substituted phenyl rings. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is soluble in organic solvents such as ethanol and ether but has limited solubility in water due to its hydrophobic aromatic structure. The presence of methoxy groups enhances its electron-donating properties, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. Additionally, 1,1′-Oxybis[2-methoxybenzene] may exhibit interesting thermal and photochemical properties, which can be explored in applications such as organic synthesis, materials science, and potentially in the development of pharmaceuticals. Safety data indicates that, like many organic compounds, it should be handled with care, using appropriate personal protective equipment to avoid inhalation or skin contact.
Formula:C14H14O3
InChI:InChI=1S/C14H14O3/c1-15-11-7-3-5-9-13(11)17-14-10-6-4-8-12(14)16-2/h3-10H,1-2H3
InChI key:InChIKey=AGZRBJLATOQBCH-UHFFFAOYSA-N
SMILES:O(C1=C(OC)C=CC=C1)C2=C(OC)C=CC=C2
Synonyms:- Benzene, 1,1′-oxybis[2-methoxy-
- 2,2′-Dimethoxydiphenyl ether
- 2,2′-Oxydiphenol dimethyl ether
- Ether, bis(o-methoxyphenyl)
- 1,1′-Oxybis[2-methoxybenzene]
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
