![Borate(1-),[5-[(3,5-dimethyl-2H-pyrrol-2-ylidene-kN)methyl]-1H-pyrrole-2-propanoato(2-)-kN1]difluo…](https://static.cymitquimica.com/cas-image/thumb-webp/191736-borate-1-5-35-dimethyl-2h-pyrrol-2-ylidene-kn-methyl-1h-pyrrole-2-propanoato-2-kn1-difluoro-hydrogen-1-1-t-4.webp)
CAS 165599-63-3
:Borate(1-),[5-[(3,5-dimethyl-2H-pyrrol-2-ylidene-kN)methyl]-1H-pyrrole-2-propanoato(2-)-kN1]difluoro-, hydrogen (1:1),(T-4)-
Description:
The chemical substance known as Borate(1-), specifically the compound with the name "5-[(3,5-dimethyl-2H-pyrrol-2-ylidene-kN)methyl]-1H-pyrrole-2-propanoato(2-)-kN1]difluoro-, hydrogen (1:1),(T-4)-" and CAS number 165599-63-3, exhibits several notable characteristics. This compound features a borate anion, which is typically characterized by its ability to form complexes with various cations and its role in biological systems, particularly in plant growth and development. The presence of the pyrrole and dimethyl groups suggests potential applications in organic synthesis and materials science, as these structures can contribute to unique electronic and optical properties. The difluoro substituents may enhance the compound's stability and reactivity, making it suitable for various chemical reactions. Additionally, the specific coordination of the borate with the organic moiety indicates potential uses in catalysis or as a ligand in coordination chemistry. Overall, this compound represents a complex interplay of organic and inorganic chemistry, with potential implications in both industrial and research applications.
Formula:C14H14BF2N2O2・H
InChI:InChI=1S/C14H15BF2N2O2/c1-9-7-10(2)18-13(9)8-12-4-3-11(5-6-14(20)21)19(12)15(18,16)17/h3-4,7-8H,5-6H2,1-2H3,(H,20,21)
InChI key:BJDJEJIINKBPHY-UHFFFAOYSA-N
SMILES:[B-]1(N2C(=CC(=C2C=C3[N+]1=C(C=C3)CCC(=O)O)C)C)(F)F
Synonyms:- Borate(1-),[5-[(3,5-dimethyl-2H-pyrrol-2-ylidene)methyl]-1H-pyrrole-2-propanoato(2-)-N1,N5]difluoro-,hydrogen, (T-4)-
- Borate(1-), [5-[(3,5-dimethyl-2H-pyrrol-2-ylidene-kN)methyl]-1H-pyrrole-2-propanoato(2-)-kN1]difluoro-, hydrogen, (T-4)-(9CI)
- Bodipy 503/512
- Bodipy Fl
- Bodipy Fl-C3
- Bodipy FL 510
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 12 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
BDP FL (1mg*3)
CAS:Formula:C14H15BF2N2O2Color and Shape:Orange to Brown powder to crystalMolecular weight:292.09BDP FL
CAS:Formula:C14H15BF2N2O2Purity:>97.0%(HPLC)Color and Shape:Light yellow to Amber to Dark green powder to crystalMolecular weight:292.093-BODIPY-PROPANOIC ACID
CAS:Formula:C14H15BF2N2O2Purity:97%Color and Shape:SolidMolecular weight:292.0889Ref: IN-DA00ADC7
25mg99.00€50mg128.00€100mg203.00€250mg322.00€1g530.00€500mg543.00€5g1,450.00€10g2,881.00€25g4,802.00€BDP FL
CAS:4,4-Difluoro-5,7-dimethyl-4-bora-3a,4a-diaza-s-indacene-3-propionic AcidFormula:C14H15BF2N2O2Purity:97%Molecular weight:292.09BODIPY-FL
CAS:BODIPY-FL is a versatile, efficient dye for labeling probes/primer and DNA/RNA quantification, also detecting bacteria/fungi.Formula:C14H15BF2N2O2Purity:98.29%Color and Shape:Red SolidMolecular weight:292.0893-Bodipy-propanoic acid
CAS:Reactive fluorescent labeling reagentFormula:C14H15BF2N2O2Color and Shape:Red PowderMolecular weight:292.09 g/mol3-Bodipy-propanoic Acid
CAS:Controlled ProductStability Hygroscopic
Applications An reactive fluorescent labeling reagent.Formula:C14H15BF2N2O2Color and Shape:NeatMolecular weight:292.09
