CymitQuimica logo

CAS 16563-93-2

:

3-(Hydroxymethyl)-3-oxetanol

Description:
3-(Hydroxymethyl)-3-oxetanol, with the CAS number 16563-93-2, is a chemical compound characterized by its oxetane ring structure, which is a four-membered cyclic ether. This compound features a hydroxymethyl group (-CH2OH) attached to the oxetane, contributing to its reactivity and potential applications in organic synthesis. The presence of the hydroxymethyl group enhances its solubility in polar solvents and may influence its hydrogen bonding capabilities. 3-(Hydroxymethyl)-3-oxetanol is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is of interest in various fields, including polymer chemistry and pharmaceuticals, due to its potential as a building block for more complex molecules. The compound's reactivity can be attributed to the strain in the oxetane ring, making it a useful intermediate in synthetic pathways. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C4H8O3
InChI:InChI=1S/C4H8O3/c5-1-4(6)2-7-3-4/h5-6H,1-3H2
InChI key:TVRBHJADIOFJDI-UHFFFAOYSA-N
SMILES:C(C1(COC1)O)O
Synonyms:
  • 3-Hydroxy-3-Hydroxymethyloxetane
Found 3 products.