CymitQuimica logo

CAS 1657-56-3

:

4,4'-DICHLORO-TRANS-STILBENE

Description:
4,4'-Dichloro-trans-stilbene is an organic compound characterized by its structure, which features two phenyl rings connected by a trans double bond and substituted with chlorine atoms at the para positions. This compound is a member of the stilbene family and is known for its potential applications in organic electronics and photochemistry. It typically appears as a crystalline solid and is relatively stable under standard conditions. The presence of chlorine substituents enhances its reactivity and can influence its electronic properties, making it of interest in various chemical syntheses and materials science. 4,4'-Dichloro-trans-stilbene exhibits specific optical properties, including fluorescence, which can be utilized in photonic applications. Additionally, it may undergo various chemical reactions, such as electrophilic substitution or reduction, depending on the reaction conditions. Safety data indicates that, like many chlorinated compounds, it should be handled with care due to potential toxicity and environmental concerns.
Formula:C14H10Cl2
InChI:InChI=1/C14H10Cl2/c15-13-7-3-11(4-8-13)1-2-12-5-9-14(16)10-6-12/h1-10H/b2-1+
InChI key:WELCIURRBCOJDX-OWOJBTEDSA-N
SMILES:C1=CC(=CC=C1/C=C/C2=CC=C(C=C2)Cl)Cl
Synonyms:
  • 4,4'-Dichloro-Trans-Stilbene 98+% Gc
  • 1,1'-(E)-ethene-1,2-diylbis(4-chlorobenzene)
Found 4 products.