
CAS 1657014-42-0
:Cyclopropanecarboxamide, N-[4-[(3R)-3-amino-1-piperidinyl]-5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl]-, hydrochloride (1:2)
Description:
Cyclopropanecarboxamide, N-[4-[(3R)-3-amino-1-piperidinyl]-5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl]-, hydrochloride (1:2) is a chemical compound characterized by its complex structure, which includes a cyclopropanecarboxamide moiety and a pyrrolopyridine derivative. The presence of a bromine atom in the pyrrolopyridine ring contributes to its reactivity and potential biological activity. The compound features a piperidine ring, which is known for its role in various pharmacological applications, particularly in the development of psychoactive and therapeutic agents. As a hydrochloride salt, it is typically more soluble in water, enhancing its bioavailability for potential medicinal use. The specific stereochemistry indicated by the (3R) designation suggests that the compound may exhibit chirality, which can influence its interaction with biological targets. Overall, this compound may be of interest in medicinal chemistry and drug development, particularly in the context of targeting specific receptors or pathways in biological systems.
Formula:C16H21BrClN5O
InChI:InChI=1S/C16H20BrN5O.2ClH/c17-11-6-19-15-13(14(11)22-5-1-2-10(18)8-22)12(7-20-15)21-16(23)9-3-4-9;;/h6-7,9-10H,1-5,8,18H2,(H,19,20)(H,21,23);2*1H/t10-;;/m1../s1
InChI key:InChIKey=OYMHZTORKRPOBI-YQFADDPSSA-N
SMILES:N(C(=O)C1CC1)C=2C3=C(C(Br)=CN=C3NC2)N4C[C@H](N)CCC4.Cl
Synonyms:- Cyclopropanecarboxamide, N-[4-[(3R)-3-amino-1-piperidinyl]-5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl]-, hydrochloride (1:2)
- EOS-62353
- GDC-0575 dihydrochloride
- GDC-0575 2HCl
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
GDC-0575 (dihydrochloride)
CAS:GDC-0575 (dihydrochloride)Formula:C16H22BrCl2N5OPurity:99.49%Molecular weight:451.19GDC-0575 dihydrochloride
CAS:GDC-0575 dihydrochloride (ARRY-575 dihydrochloride) is a selective, orally active CHK1 inhibitor (IC50: 1.2 nM) that exhibits antitumour effects.Formula:C16H22BrCl2N5OColor and Shape:SolidMolecular weight:451.19GDC-0575 dihydrochloride
CAS:GDC-0575 is a potent, selective, and orally available inhibitor of the voltage-gated potassium channel Kv1.3. It has been shown to inhibit Kv1.3 in both native and recombinant systems with an IC50 of less than 1 nM for both channels. GDC-0575 has been shown to have no effect on other voltage-gated ion channels tested, such as Kv2.1 and Kv4.2, which are expressed in many tissues including the brain, heart, and skeletal muscle. GDC-0575 is also selective for Kv1.3 over other closely related ion channels such as Kv4.2 and Shaker B channels (Kv1) with inhibition constants in the low nanomolar range.Formula:C17H23BrCl2N4OPurity:Min. 95%Molecular weight:450.2 g/mol



