CAS 16582-58-4
:2-Benzothiazolamine, 6-iodo-
Description:
2-Benzothiazolamine, 6-iodo- is an organic compound characterized by the presence of a benzothiazole ring, which is a bicyclic structure containing both a benzene and a thiazole moiety. The "6-iodo" designation indicates that an iodine atom is substituted at the sixth position of the benzothiazole ring. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to the presence of the nitrogen and sulfur atoms in the thiazole ring. It may be used in various applications, including pharmaceuticals, agrochemicals, and as a building block in organic synthesis. The iodine substitution can enhance the compound's reactivity and influence its solubility and stability. As with many halogenated compounds, it may also exhibit unique electronic properties, making it of interest in materials science and medicinal chemistry. Safety and handling precautions should be observed, as halogenated compounds can pose health risks and environmental concerns.
Formula:C7H5IN2S
InChI:InChI=1S/C7H5IN2S/c8-4-1-2-5-6(3-4)11-7(9)10-5/h1-3H,(H2,9,10)
InChI key:WMKLSFIAHMBOTP-UHFFFAOYSA-N
SMILES:C1=CC2=C(C=C1I)SC(=N2)N
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
6-Iodobenzo[d]thiazol-2-amine
CAS:6-Iodobenzo[d]thiazol-2-amineFormula:C7H5IN2SPurity:97%Molecular weight:276.16-Iodobenzo[d]thiazol-2-amine
CAS:Formula:C7H5IN2SPurity:95%Color and Shape:SolidMolecular weight:276.09756-Iodobenzo[d]thiazol-2-amine
CAS:6-Iodobenzo[d]thiazol-2-amineFormula:C7H5IN2SPurity:95%Molecular weight:276.16-Iodobenzo[d]thiazol-2-amine
CAS:Formula:C7H5IN2SPurity:97%Color and Shape:SolidMolecular weight:276.16-Iodobenzo[d]thiazol-2-amine
CAS:6-Iodobenzo[d]thiazol-2-amine is an antimicrobial agent that has been shown to have antimycobacterial activity against Mycobacterium tuberculosis. 6-Iodobenzo[d]thiazol-2-amine inhibits the synthesis of mycolic acid, which is a key component in the cell wall of the bacteria. It also has shown to be effective against other bacteria such as Staphylococcus aureus and Pseudomonas aeruginosa. The mechanism of action is not fully understood but may involve binding to bacterial DNA or RNA, inhibiting protein synthesis, or altering cellular membranes. This compound is used as a building block for drug development, where it can be conjugated with other molecules to form new compounds with different properties.Formula:C7H5IN2SPurity:Min. 95%Molecular weight:276.1 g/mol




