CymitQuimica logo

CAS 16582-58-4

:

2-Benzothiazolamine, 6-iodo-

Description:
2-Benzothiazolamine, 6-iodo- is an organic compound characterized by the presence of a benzothiazole ring, which is a bicyclic structure containing both a benzene and a thiazole moiety. The "6-iodo" designation indicates that an iodine atom is substituted at the sixth position of the benzothiazole ring. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to the presence of the nitrogen and sulfur atoms in the thiazole ring. It may be used in various applications, including pharmaceuticals, agrochemicals, and as a building block in organic synthesis. The iodine substitution can enhance the compound's reactivity and influence its solubility and stability. As with many halogenated compounds, it may also exhibit unique electronic properties, making it of interest in materials science and medicinal chemistry. Safety and handling precautions should be observed, as halogenated compounds can pose health risks and environmental concerns.
Formula:C7H5IN2S
InChI:InChI=1S/C7H5IN2S/c8-4-1-2-5-6(3-4)11-7(9)10-5/h1-3H,(H2,9,10)
InChI key:WMKLSFIAHMBOTP-UHFFFAOYSA-N
SMILES:C1=CC2=C(C=C1I)SC(=N2)N
Found 5 products.