CymitQuimica logo

CAS 16583-76-9

:

2-CHLORO-6-(TRIFLUOROMETHYL)PHENYL

Description:
2-Chloro-6-(trifluoromethyl)phenyl, identified by the CAS number 16583-76-9, is an organic compound characterized by the presence of a chloro group and a trifluoromethyl group attached to a phenyl ring. The chloro substituent typically enhances the compound's reactivity and can influence its electronic properties, while the trifluoromethyl group is known for imparting unique characteristics such as increased lipophilicity and stability against oxidation. This compound is likely to exhibit significant hydrophobic interactions due to the presence of the trifluoromethyl group, making it useful in various applications, including pharmaceuticals and agrochemicals. Additionally, the presence of halogens can affect the compound's solubility and volatility. The overall structure suggests potential applications in synthetic chemistry, particularly in the development of more complex molecules through reactions such as nucleophilic substitution or cross-coupling reactions. As with many halogenated compounds, safety precautions should be observed due to potential toxicity and environmental impact.
Formula:C8H3ClF3NO
InChI:InChI=1/C8H3ClF3NO/c9-6-3-1-2-5(8(10,11)12)7(6)13-4-14/h1-3H
SMILES:c1cc(c(c(c1)Cl)N=C=O)C(F)(F)F
Synonyms:
  • Benzene, 1-Chloro-2-Isocyanato-3-(Trifluoromethyl)-
  • Ocnr Bg Fxfff [Wln]
  • 1-Chloro-2-Isocyanato-3-(Trifluoromethyl)Benzene
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.