CAS 165894-09-7

7-benzyl-5,6,7,8-tetrahydroimidazo[1,5-a]pyrazine

Description:

7-benzyl-5,6,7,8-tetrahydroimidazo[1,5-a]pyrazine is a heterocyclic organic compound characterized by its fused imidazole and pyrazine rings, which contribute to its unique chemical properties. This compound features a benzyl group, enhancing its lipophilicity and potentially influencing its biological activity. The tetrahydro configuration indicates the presence of saturated carbon atoms in the ring structure, which can affect the compound's reactivity and stability. Typically, such compounds may exhibit interesting pharmacological properties, making them of interest in medicinal chemistry. The presence of nitrogen atoms in the ring system often leads to diverse interactions with biological targets, including enzyme inhibition or receptor modulation. Additionally, the compound's solubility, melting point, and other physical properties would be influenced by its molecular structure and substituents. Overall, 7-benzyl-5,6,7,8-tetrahydroimidazo[1,5-a]pyrazine represents a class of compounds that may have significant implications in drug discovery and development.

Formula: C₁₃H₁₅N₃

InChI: InChI=1/C13H15N3/c1-2-4-12(5-3-1)9-15-6-7-16-11-14-8-13(16)10-15/h1-5,8,11H,6-7,9-10H2

SMILES: c1ccc(cc1)CN1CCn2cncc2C1

Synonyms:

• Imidazo[1,5-a]pyrazine, 5,6,7,8-tetrahydro-7-(phenylmethyl)-
• 7-BENZYL-5,6,7,8-TETRAHYDROIMIDAZO[1,5-A]PYRAZINE
• 7-benzyl-4H,5H,6H,7H-iMidazo[1,5-a]pyrazine
• 7-benzyl-6,8-dihydro-5H-imidazo[1,5-a]pyrazine

Imidazo[1,5-a]pyrazine, 5,6,7,8-tetrahydro-7-(phenylmethyl)-

CAS: 165894-09-7

Formula: C₁₃H₁₅N₃

Purity: 97%

Molecular weight: 213.2783

Ref: IN-DA001WEH