CymitQuimica logo

CAS 165947-48-8

:

5-(1,1-Dimethylethyl) 6,7-dihydrothieno[3,2-c]pyridine-2,5(4H)-dicarboxylate

Description:
5-(1,1-Dimethylethyl) 6,7-dihydrothieno[3,2-c]pyridine-2,5(4H)-dicarboxylate, with the CAS number 165947-48-8, is a chemical compound characterized by its unique bicyclic structure that incorporates both thieno and pyridine moieties. This compound features a dicarboxylate functional group, which contributes to its potential reactivity and solubility properties. The presence of the tert-butyl group (1,1-dimethylethyl) enhances its lipophilicity, making it more soluble in organic solvents. The thieno and pyridine rings provide a platform for various chemical interactions, potentially allowing for applications in medicinal chemistry, particularly in the development of pharmaceuticals. The compound's structural features may also influence its biological activity, making it a candidate for further investigation in drug discovery. Overall, its unique structural characteristics and functional groups suggest potential utility in various chemical and biological applications, warranting further research into its properties and effects.
Formula:C13H17NO4S
InChI:InChI=1S/C13H17NO4S/c1-13(2,3)18-12(17)14-5-4-9-8(7-14)6-10(19-9)11(15)16/h6H,4-5,7H2,1-3H3,(H,15,16)
InChI key:InChIKey=VYACEHZLOWZZEV-UHFFFAOYSA-N
SMILES:C(OC(C)(C)C)(=O)N1CC2=C(SC(C(O)=O)=C2)CC1
Synonyms:
  • 5-(1,1-Dimethylethyl) 6,7-dihydrothieno[3,2-c]pyridine-2,5(4H)-dicarboxylate
  • 5-Boc-4,5,6,7-Tetrahydrothieno[3,2-C]Pyridine-2-Carboxylic Acid
  • Thieno[3,2-c]pyridine-2,5(4H)-dicarboxylic acid, 6,7-dihydro-, 5-(1,1-dimethylethyl) ester
  • 5-tert-Butoxycarbonyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridine-2-carboxylic acid
Found 4 products.