CymitQuimica logo

CAS 165947-55-7

:

Thieno[3,2-c]pyridine-5(4H)-carboxylic acid, 2-formyl-6,7-dihydro-,1,1-dimethylethyl ester

Description:
Thieno[3,2-c]pyridine-5(4H)-carboxylic acid, 2-formyl-6,7-dihydro-, 1,1-dimethylethyl ester, identified by CAS number 165947-55-7, is a chemical compound characterized by its unique bicyclic structure that incorporates both thieno and pyridine moieties. This compound features a carboxylic acid functional group, which is esterified with a tert-butyl group, enhancing its lipophilicity and potentially influencing its biological activity. The presence of the formyl group contributes to its reactivity, making it a versatile intermediate in organic synthesis. The compound is likely to exhibit properties typical of heterocyclic compounds, such as potential pharmacological activity, owing to the presence of nitrogen and sulfur in its structure. Its solubility, stability, and reactivity can vary depending on the solvent and environmental conditions. Overall, this compound may have applications in medicinal chemistry, particularly in the development of novel therapeutic agents, due to its structural features that allow for diverse functionalization and interaction with biological targets.
Formula:C13H17NO3S
InChI:InChI=1S/C13H17NO3S/c1-13(2,3)17-12(16)14-5-4-11-9(7-14)6-10(8-15)18-11/h6,8H,4-5,7H2,1-3H3
InChI key:LEONLAFPFCQRNM-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)N1CCC2=C(C1)C=C(S2)C=O
Found 3 products.