CymitQuimica logo

CAS 166039-38-9

:

4-Quinazolinamine, 2-phenyl-N-(3-pyridinylmethyl)-

Description:
4-Quinazolinamine, 2-phenyl-N-(3-pyridinylmethyl)-, identified by CAS number 166039-38-9, is a chemical compound that belongs to the class of quinazolinamines, which are characterized by a fused bicyclic structure containing a quinazoline moiety. This compound features a phenyl group and a pyridinylmethyl substituent, contributing to its potential biological activity. Typically, quinazolinamine derivatives exhibit a range of pharmacological properties, including anti-cancer, anti-inflammatory, and antimicrobial activities. The presence of the pyridine ring may enhance its interaction with biological targets, such as enzymes or receptors. The compound's solubility, stability, and reactivity can vary based on its substituents and the overall molecular structure. As with many organic compounds, its synthesis may involve multi-step reactions, and it may be characterized using techniques such as NMR spectroscopy, mass spectrometry, and X-ray crystallography. Understanding its properties and behavior in biological systems is crucial for exploring its potential applications in medicinal chemistry and drug development.
Formula:C20H16N4
InChI:InChI=1S/C20H16N4/c1-2-8-16(9-3-1)19-23-18-11-5-4-10-17(18)20(24-19)22-14-15-7-6-12-21-13-15/h1-13H,14H2,(H,22,23,24)
InChI key:NWGXQMVEYOMULC-UHFFFAOYSA-N
SMILES:C1=CC=C(C=C1)C2=NC3=CC=CC=C3C(=N2)NCC4=CN=CC=C4
Synonyms:
  • 2-Phenyl-N-(pyridin-3-ylmethyl)quinazolin-4-amine
  • 4-Quinazolinamine, 2-phenyl-N-(3-pyridinylmethyl)-
  • WAY-321002
Found 3 products.