
CAS 16610-44-9
:N-(2-Methylphenyl)anthranilic acid
Description:
N-(2-Methylphenyl)anthranilic acid, with the CAS number 16610-44-9, is an organic compound that belongs to the class of anthranilic acids. It features an anthranilic acid backbone, which is an amino-substituted benzoic acid, with a 2-methylphenyl group attached to the nitrogen atom of the amino group. This compound typically exhibits properties such as being a solid at room temperature, with moderate solubility in polar solvents like water and alcohols, while being less soluble in non-polar solvents. Its structure contributes to its potential applications in pharmaceuticals, particularly as an intermediate in the synthesis of various dyes and drugs. The presence of both the carboxylic acid and amino functional groups allows for diverse reactivity, making it a valuable compound in organic synthesis. Additionally, it may exhibit biological activity, which could be of interest in medicinal chemistry. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.
Formula:C14H13NO2
InChI:InChI=1S/C14H13NO2/c1-10-6-2-4-8-12(10)15-13-9-5-3-7-11(13)14(16)17/h2-9,15H,1H3,(H,16,17)
InChI key:InChIKey=WAEMHISTVIYWOY-UHFFFAOYSA-N
SMILES:N(C1=C(C(O)=O)C=CC=C1)C2=C(C)C=CC=C2
Synonyms:- Benzoic acid, 2-[(2-methylphenyl)amino]-
- N-(2-Methylphenyl)anthranilic acid
- 2-[(2-Methylphenyl)amino]benzoic acid
- Anthranilic acid, N-o-tolyl-
- N-(o-Tolyl)anthranilic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
