CymitQuimica logo

CAS 16617-02-0

:

Propanamide, N,N′-(iminodicarbonyl)bis-

Description:
Propanamide, N,N'-(iminodicarbonyl)bis- is a chemical compound characterized by its amide functional groups and the presence of two carbonyl (C=O) functionalities linked through an imine (C=N) bond. This compound typically exhibits properties associated with amides, such as moderate solubility in polar solvents and the ability to participate in hydrogen bonding due to the presence of the amide nitrogen. The structure suggests that it may have applications in organic synthesis or as an intermediate in the production of more complex molecules. The presence of the iminodicarbonyl moiety indicates potential reactivity, particularly in nucleophilic addition reactions, which could be exploited in various chemical processes. Additionally, the compound may exhibit specific thermal and stability characteristics influenced by its functional groups. As with many organic compounds, safety data should be consulted to understand its handling, storage, and potential hazards. Overall, the unique structural features of Propanamide, N,N'-(iminodicarbonyl)bis- contribute to its chemical behavior and potential applications in research and industry.
Formula:C8H13N3O4
InChI:InChI=1S/C8H13N3O4/c1-3-5(12)9-7(14)11-8(15)10-6(13)4-2/h3-4H2,1-2H3,(H3,9,10,11,12,13,14,15)
InChI key:InChIKey=MCYAQWMHCWERNH-UHFFFAOYSA-N
SMILES:N(C(NC(CC)=O)=O)C(NC(CC)=O)=O
Synonyms:
  • 1,5-Dipropanoylbiuret
  • Biuret, 1,5-dipropionyl-
  • Propanamide, N,N′-(iminodicarbonyl)bis-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.