CAS 166316-48-9
:4-(2-Carboxyethyl)benzeneboronic acid
Description:
4-(2-Carboxyethyl)benzeneboronic acid, with the CAS number 166316-48-9, is an organoboron compound characterized by the presence of a boronic acid functional group and a carboxyethyl substituent on a benzene ring. This compound typically appears as a white to off-white solid and is soluble in polar solvents such as water and alcohols, owing to the presence of both the carboxylic acid and boronic acid functionalities. It exhibits properties typical of boronic acids, including the ability to form reversible complexes with diols, which makes it useful in various applications, including organic synthesis and medicinal chemistry. The carboxyethyl group enhances its reactivity and solubility, making it a valuable intermediate in the synthesis of more complex molecules. Additionally, it may play a role in biological systems, particularly in the context of drug development and targeting specific biomolecules. Overall, 4-(2-Carboxyethyl)benzeneboronic acid is a versatile compound with significant implications in both synthetic and medicinal chemistry.
Formula:C9H11BO4
InChI:InChI=1/C9H11BO4/c11-9(12)6-3-7-1-4-8(5-2-7)10(13)14/h1-2,4-5,13-14H,3,6H2,(H,11,12)
SMILES:c1cc(ccc1CCC(=O)O)B(O)O
Synonyms:- 3-(4-Boronophenyl)propionic acid~4-(2-Carboxyethyl)phenylboronic acid
- 3-[4-(Dihydroxyboranyl)Phenyl]Propanoic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3-(4-Boronophenyl)propanoic acid
CAS:Formula:C9H11BO4Purity:95%Color and Shape:White powderMolecular weight:193.994-(2-Carboxyethyl)benzeneboronic acid, 97%
CAS:4-(2-Carboxyethyl)benzeneboronic acid is an important organic intermediate. It is used in agrochemical, pharmaceutical and dyestuff field. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to theFormula:C9H11BO4Purity:97%Color and Shape:White, Crystals or powder or crystalline powder or fused/lumpy solidMolecular weight:193.994-(2-Carboxyethyl)benzeneboronic acid
CAS:4-(2-Carboxyethyl)benzeneboronic acidFormula:C9H11BO4Purity:98%Color and Shape:White Solid-PowderMolecular weight:193.99224Benzenepropanoic acid, 4-borono-
CAS:Formula:C9H11BO4Purity:98%Color and Shape:SolidMolecular weight:193.9922




