CAS 166398-34-1
:1,2,3,4-Tetrahydroisoquinoline-6-carbonitrile
Description:
1,2,3,4-Tetrahydroisoquinoline-6-carbonitrile is a chemical compound characterized by its bicyclic structure, which includes a tetrahydroisoquinoline moiety and a cyano group. This compound typically exhibits a molecular formula that reflects its complex structure, incorporating both nitrogen and carbon atoms. It is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its ability to interact with biological targets. The presence of the cyano group can enhance its reactivity and influence its pharmacological properties. Additionally, the compound may exhibit specific physical properties such as solubility in organic solvents and a distinct melting point, which are important for its handling and application in research. Its synthesis often involves multi-step organic reactions, and it may serve as an intermediate in the production of more complex molecules. As with many organic compounds, safety data sheets should be consulted for handling and toxicity information.
Formula:C10H10N2
InChI:InChI=1S/C10H10N2/c11-6-8-1-2-10-7-12-4-3-9(10)5-8/h1-2,5,12H,3-4,7H2
InChI key:InChIKey=RKWNQODBLXZUES-UHFFFAOYSA-N
SMILES:C(#N)C=1C=C2C(=CC1)CNCC2
Synonyms:- 1,2,3,4-Tetrahydro-6-isoquinolinecarbonitrile
- 1,2,3,4-Tetrahydroisoquinoline-6-Carbonitrile Hydrochloride (1:1)
- 6-Isoquinolinecarbonitrile, 1,2,3,4-tetrahydro-
- 6-Trifluoro-1,2,3,4-Tetrahydroisoquinoline
- 1,2,3,4-Tetrahydroisoquinoline-6-carbonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
