CAS 166442-40-6

2-[4-(Dimethylamino)-2-hydroxybenzoyl]-4-nitrobenzoic acid

Description:

2-[4-(Dimethylamino)-2-hydroxybenzoyl]-4-nitrobenzoic acid, with the CAS number 166442-40-6, is an organic compound characterized by its complex structure, which includes a benzoyl moiety substituted with both a dimethylamino group and a nitro group. This compound typically exhibits properties such as being a solid at room temperature, with potential solubility in organic solvents due to its aromatic nature. The presence of the hydroxyl and nitro groups suggests that it may engage in hydrogen bonding and exhibit acidic properties, making it a candidate for various chemical reactions. Its dimethylamino group can contribute to its basicity and influence its reactivity, particularly in electrophilic aromatic substitution reactions. Additionally, this compound may have applications in fields such as pharmaceuticals or materials science, where its unique functional groups can impart specific biological or chemical properties. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₁₆H₁₄N₂O₆

InChI: InChI=1S/C16H14N2O6/c1-17(2)9-3-6-12(14(19)8-9)15(20)13-7-10(18(23)24)4-5-11(13)16(21)22/h3-8,19H,1-2H3,(H,21,22)

InChI key: InChIKey=ISSFRVNVTUDNLA-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(C(O)=O)C=CC(N(=O)=O)=C1)C2=C(O)C=C(N(C)C)C=C2

Synonyms:

• Benzoic acid, 2-[4-(dimethylamino)-2-hydroxybenzoyl]-4-nitro-
• 2-[4-(Dimethylamino)-2-hydroxybenzoyl]-4-nitrobenzoic acid

Benzoic acid, 2-[4-(dimethylamino)-2-hydroxybenzoyl]-4-nitro-

CAS: 166442-40-6

Formula: C₁₆H₁₄N₂O₆

Color and Shape: Solid

Molecular weight: 330.2922

Ref: IN-DA001WQZ

2’-Carboxy-4-dimethylamino-2-hydroxy-5’-nitrobenzophenone

Controlled Product

CAS: 166442-40-6

Applications An intermediate used for the preparation of rhodamine derivatives as fluorescent labels.

Formula: C₁₆H₁₄N₂O₆

Color and Shape: Neat

Molecular weight: 330.29

Ref: TR-C177905