CAS 166599-84-4
:benzofuran-4-carboxylic acid
Description:
Benzofuran-4-carboxylic acid is an organic compound characterized by its fused benzene and furan rings, with a carboxylic acid functional group at the fourth position of the benzofuran structure. This compound typically appears as a white to off-white solid and is known for its aromatic properties, which contribute to its stability and reactivity. It is soluble in organic solvents and exhibits moderate solubility in water, influenced by the presence of the carboxylic acid group. Benzofuran-4-carboxylic acid is often utilized in organic synthesis and medicinal chemistry, serving as a building block for various pharmaceuticals and agrochemicals. Its derivatives may exhibit biological activity, making it of interest in drug development. The compound's reactivity can be attributed to the electrophilic nature of the aromatic system and the acidic hydrogen of the carboxylic group, allowing for various chemical transformations. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken during use.
Formula:C9H6O3
InChI:InChI=1/C9H6O3/c10-9(11)7-2-1-3-8-6(7)4-5-12-8/h1-5H,(H,10,11)
SMILES:c1cc(c2ccoc2c1)C(=O)O
Synonyms:- 4-Benzofurancarboxylicacid
- 1-Benzofuran-4-Carboxylic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Benzofuran-4-carboxylic acid
CAS:Benzofuran-4-carboxylic acidFormula:C9H6O3Purity:97%Molecular weight:162.14Benzofuran-4-carboxylic acid
CAS:Benzofuran-4-carboxylic acidFormula:C9H6O3Purity:95%Molecular weight:162.144-Benzofurancarboxylic Acid
CAS:Formula:C9H6O3Purity:95%Color and Shape:SolidMolecular weight:162.1421Benzofuran-4-carboxylic acid
CAS:Formula:C9H6O3Purity:97%Color and Shape:SolidMolecular weight:162.1444-Benzofurancarboxylic Acid
CAS:4-Benzofurancarboxylic acid is an organic compound with the formula CH(CO2H)2. It is a white crystalline solid that is soluble in many organic solvents. The compound has a carboxyl group, and it reacts as an acid to give salts with various metals. 4-Benzofurancarboxylic acid also undergoes Friedel-Crafts reactions and can be synthesized by reacting carbon disulfide with acetyl chloride, which gives the product in high yield.Formula:C9H6O3Purity:Min. 95%Molecular weight:162.14 g/mol




