CymitQuimica logo

CAS 16668-83-0

:

2-Fluoroadamantane

Description:
2-Fluoroadamantane is a fluorinated derivative of adamantane, characterized by the presence of a fluorine atom at the second position of the adamantane structure. This compound exhibits a rigid, cage-like hydrocarbon framework, which contributes to its unique physical and chemical properties. It is typically a colorless solid at room temperature and is known for its high thermal stability and low reactivity due to the saturated nature of the adamantane core. The introduction of the fluorine atom enhances its lipophilicity and can influence its biological activity, making it of interest in medicinal chemistry, particularly in the development of antiviral agents. Additionally, 2-fluoroadamantane may exhibit interesting properties such as increased solubility in organic solvents and potential applications in materials science. Its molecular structure allows for potential interactions with biological targets, which can be explored in drug design. Overall, 2-fluoroadamantane represents a valuable compound in both synthetic and applied chemistry contexts.
Formula:C10H15F
InChI:InChI=1/C10H15F/c11-10-8-2-6-1-7(4-8)5-9(10)3-6/h6-10H,1-5H2
SMILES:C1C2CC3CC1CC(C2)C3F
Synonyms:
  • 2-Fluorotricyclo[3.3.1.1~3,7~]Decane
  • 2-Fluoroadamantane
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.