CAS 166734-82-3
:(S)-Imazalil
Description:
(S)-Imazalil is a chiral imidazole derivative primarily used as a fungicide in agriculture, particularly for post-harvest treatment of fruits and vegetables. It exhibits broad-spectrum antifungal activity against various pathogens, making it effective in preventing fungal infections. The compound is characterized by its ability to inhibit the biosynthesis of ergosterol, a vital component of fungal cell membranes, thereby disrupting fungal growth. (S)-Imazalil is typically applied as a systemic fungicide, allowing it to be absorbed by plants and provide protection from within. Its chemical structure includes a substituted imidazole ring, contributing to its biological activity. The substance is generally considered to have low toxicity to mammals, but safety assessments are essential for its use in food products. Environmental persistence and potential effects on non-target organisms are also important considerations in its application. Overall, (S)-Imazalil plays a significant role in agricultural practices, helping to enhance crop yield and quality while managing fungal diseases.
Formula:C14H14Cl2N2O
InChI:InChI=1S/C14H14Cl2N2O/c1-2-7-19-14(9-18-6-5-17-10-18)12-4-3-11(15)8-13(12)16/h2-6,8,10,14H,1,7,9H2/t14-/m1/s1
InChI key:InChIKey=PZBPKYOVPCNPJY-CQSZACIVSA-N
SMILES:[C@H](CN1C=CN=C1)(OCC=C)C2=C(Cl)C=C(Cl)C=C2
Synonyms:- 1-[(2S)-2-(2,4-Dichlorophenyl)-2-(2-propen-1-yloxy)ethyl]-1H-imidazole
- 1H-Imidazole, 1-[(2S)-2-(2,4-dichlorophenyl)-2-(2-propenyloxy)ethyl]-
- (S)-Imazalil
- 1H-Imidazole, 1-[(2S)-2-(2,4-dichlorophenyl)-2-(2-propen-1-yloxy)ethyl]-
- 1H-Imidazole, 1-[2-(2,4-dichlorophenyl)-2-(2-propenyloxy)ethyl]-, (S)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
