CymitQuimica logo

CAS 16675-64-2

:

4-(3,4-Dihydro-4,7-dihydroxy-6-methoxy-2(1H)-isoquinolinyl)-2-butanone

Description:
4-(3,4-Dihydro-4,7-dihydroxy-6-methoxy-2(1H)-isoquinolinyl)-2-butanone, with the CAS number 16675-64-2, is a chemical compound that belongs to the class of isoquinoline derivatives. This substance is characterized by its complex molecular structure, which includes a butanone moiety and a substituted isoquinoline ring. The presence of multiple hydroxyl groups and a methoxy group contributes to its potential biological activity, possibly influencing its solubility and reactivity. Isoquinoline derivatives are often studied for their pharmacological properties, including antioxidant, anti-inflammatory, and neuroprotective effects. The compound may exhibit various interactions with biological systems, making it of interest in medicinal chemistry and drug development. Its specific characteristics, such as melting point, boiling point, and spectral data, would typically be determined through experimental methods. Overall, this compound represents a unique structure that may hold significance in the field of organic chemistry and pharmacology.
Formula:C14H19NO4
InChI:InChI=1S/C14H19NO4/c1-9(16)3-4-15-7-10-5-12(17)14(19-2)6-11(10)13(18)8-15/h5-6,13,17-18H,3-4,7-8H2,1-2H3
InChI key:InChIKey=PIEXRCRXGSYDSD-UHFFFAOYSA-N
SMILES:OC1C=2C(CN(CCC(C)=O)C1)=CC(O)=C(OC)C2
Synonyms:
  • NSC 131684
  • 4-(3,4-Dihydro-4,7-dihydroxy-6-methoxy-2(1H)-isoquinolinyl)-2-butanone
  • 2-Butanone, 4-(3,4-dihydro-4,7-dihydroxy-6-methoxy-2(1H)-isoquinolyl)-
  • 2-Butanone, 4-(3,4-dihydro-4,7-dihydroxy-6-methoxy-2(1H)-isoquinolinyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.