CAS 166751-33-3
:6-amino-2-[(2-methylbenzyl)sulfanyl]pyrimidin-4(1H)-one
Description:
6-Amino-2-[(2-methylbenzyl)sulfanyl]pyrimidin-4(1H)-one is a chemical compound characterized by its pyrimidine core, which features an amino group at the 6-position and a sulfanyl group attached to a 2-methylbenzyl moiety. This structure suggests potential biological activity, as pyrimidines are often found in nucleic acids and various pharmaceuticals. The presence of the amino group may enhance its solubility and reactivity, while the sulfanyl group can contribute to its interaction with biological targets. The compound's molecular framework indicates it may participate in hydrogen bonding and other intermolecular interactions, which are crucial for its potential applications in medicinal chemistry. Additionally, the presence of the 2-methylbenzyl group may influence its lipophilicity and overall pharmacokinetic properties. Overall, this compound's unique structural features suggest it could be of interest in drug development or as a biochemical probe, although specific biological activities would need to be investigated through experimental studies.
Formula:C12H13N3OS
InChI:InChI=1/C12H13N3OS/c1-8-4-2-3-5-9(8)7-17-12-14-10(13)6-11(16)15-12/h2-6H,7H2,1H3,(H3,13,14,15,16)
SMILES:Cc1ccccc1CSc1nc(cc(n1)O)N
Synonyms:- 4(3H)-pyrimidinone, 6-amino-2-[[(2-methylphenyl)methyl]thio]-
- 6-Amino-2-[(2-methylbenzyl)sulfanyl]pyrimidin-4(3H)-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
