CymitQuimica logo

CAS 16679-04-2

:

3-{[(2-ethylhexyl)sulfanyl]methyl}heptane

Description:
3-{[(2-Ethylhexyl)sulfanyl]methyl}heptane, with the CAS number 16679-04-2, is an organic compound characterized by its unique structure that includes a heptane backbone with a sulfanyl (thioether) functional group. This compound features a 2-ethylhexyl group attached to a sulfur atom, which is further connected to a methyl group on the third carbon of the heptane chain. The presence of the sulfanyl group imparts specific chemical properties, such as increased reactivity and potential for forming various derivatives. The compound is likely to be hydrophobic due to its long carbon chain, making it soluble in organic solvents but insoluble in water. Its molecular structure suggests potential applications in fields such as organic synthesis, materials science, or as an intermediate in the production of other chemical compounds. Additionally, the presence of the sulfur atom may influence its behavior in biological systems, although specific biological activity would require further investigation. Overall, this compound exemplifies the diversity of organic chemistry and the significance of functional groups in determining chemical behavior.
Formula:C16H34S
InChI:InChI=1/C16H34S/c1-5-9-11-15(7-3)13-17-14-16(8-4)12-10-6-2/h15-16H,5-14H2,1-4H3
SMILES:CCCCC(CC)CSCC(CC)CCCC
Synonyms:
  • Bis(2-Ethylhexyl) Sulfide
  • Heptane, 3,3'-[Thiobis(Methylene)]Bis-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.