CymitQuimica logo

CAS 16681-69-9

:

1-Methyl-1H-1,2,3-triazole-4-carboxaldehyde

Description:
1-Methyl-1H-1,2,3-triazole-4-carboxaldehyde is a heterocyclic organic compound characterized by the presence of a triazole ring, which is a five-membered ring containing three nitrogen atoms. This compound features a methyl group at the 1-position and an aldehyde functional group at the 4-position of the triazole ring, contributing to its reactivity and potential applications in organic synthesis. The presence of the aldehyde group makes it a versatile intermediate in the synthesis of various pharmaceuticals and agrochemicals. Additionally, the triazole moiety is known for its biological activity, including antifungal and antimicrobial properties. The compound is typically a solid at room temperature and is soluble in polar solvents, which enhances its utility in various chemical reactions. Its CAS number, 16681-69-9, is a unique identifier that facilitates the identification and sourcing of this compound in chemical databases and literature. Overall, 1-Methyl-1H-1,2,3-triazole-4-carboxaldehyde is significant in both research and industrial applications due to its unique structural features and functional groups.
Formula:C4H5N3O
InChI:InChI=1S/C4H5N3O/c1-7-2-4(3-8)5-6-7/h2-3H,1H3
InChI key:InChIKey=FRJSHBUKQSGJNG-UHFFFAOYSA-N
SMILES:C(=O)C1=CN(C)N=N1
Synonyms:
  • 1-Methyl-1H-1,2,3-triazole-4-carbaldehyde
  • 1-Methyl-1H-1,2,3-triazole-4-carboxaldehyde
  • 1-Methyl-1,2,3-triazole-4-carboxaldehyde
  • 1H-1,2,3-Triazole-4-carboxaldehyde, 1-methyl-
Found 4 products.